C20H22FN3O5S2 — CID 3678645
2-[(2-acetyl-4-fluorophenoxy)methyl]-N-(4-sulfamoylphenyl)morpholine-4-carbothioamide (PubChem CID 3678645) has the molecular formula C20H22FN3O5S2 and a molecular weight of 467.54 g/mol. Its IUPAC name is 2-[(2-acetyl-4-fluorophenoxy)methyl]-N-(4-sulfamoylphenyl)morpholine-4-carbothioamide.
| Compound Name | 2-[(2-acetyl-4-fluorophenoxy)methyl]-N-(4-sulfamoylphenyl)morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 3678645 |
| Molecular Formula | C20H22FN3O5S2 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 2-[(2-acetyl-4-fluorophenoxy)methyl]-N-(4-sulfamoylphenyl)morpholine-4-carbothioamide |
| SMILES | CC(=O)c1cc(F)ccc1OCC1CN(C(=S)Nc2ccc(S(N)(=O)=O)cc2)CCO1 |
| InChI | InChI=1S/C20H22FN3O5S2/c1-13(25)18-10-14(21)2-7-19(18)29-12-16-11-24(8-9-28-16)20(30)23-15-3-5-17(6-4-15)31(22,26)27/h2-7,10,16H,8-9,11-12H2,1H3,(H,23,30)(H2,22,26,27) |
| InChIKey | CFOWDWCBPAVCCU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|