C25H32FN3O4S — CID 93338959
N-[[(2R)-4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-3,4-dimethoxy-N-(2-methylpropyl)benzamide (PubChem CID 93338959) has the molecular formula C25H32FN3O4S and a molecular weight of 489.61 g/mol. Its IUPAC name is N-[[(2R)-4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-3,4-dimethoxy-N-(2-methylpropyl)benzamide.
| Compound Name | N-[[(2R)-4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-3,4-dimethoxy-N-(2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 93338959 |
| Molecular Formula | C25H32FN3O4S |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | N-[[(2R)-4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-3,4-dimethoxy-N-(2-methylpropyl)benzamide |
| SMILES | COc1ccc(C(=O)N(CC(C)C)C[C@@H]2CN(C(=S)Nc3ccc(F)cc3)CCO2)cc1OC |
| InChI | InChI=1S/C25H32FN3O4S/c1-17(2)14-29(24(30)18-5-10-22(31-3)23(13-18)32-4)16-21-15-28(11-12-33-21)25(34)27-20-8-6-19(26)7-9-20/h5-10,13,17,21H,11-12,14-16H2,1-4H3,(H,27,34)/t21-/m0/s1 |
| InChIKey | JBFJEMXHTODBDQ-NRFANRHFSA-N |
| XLogP | 4.04 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|