C25H30FN3O3S — CID 42862616
N-cyclopentyl-N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-4-methoxybenzamide (PubChem CID 42862616) has the molecular formula C25H30FN3O3S and a molecular weight of 471.60 g/mol. Its IUPAC name is N-cyclopentyl-N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-4-methoxybenzamide.
| Compound Name | N-cyclopentyl-N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 42862616 |
| Molecular Formula | C25H30FN3O3S |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-cyclopentyl-N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CC2CN(C(=S)Nc3ccc(F)cc3)CCO2)C2CCCC2)cc1 |
| InChI | InChI=1S/C25H30FN3O3S/c1-31-22-12-6-18(7-13-22)24(30)29(21-4-2-3-5-21)17-23-16-28(14-15-32-23)25(33)27-20-10-8-19(26)9-11-20/h6-13,21,23H,2-5,14-17H2,1H3,(H,27,33) |
| InChIKey | TWOCSMLILLXZFB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|