C23H30N2O4 — CID 42862547
N-cyclopentyl-N-[[4-(furan-2-ylmethyl)morpholin-2-yl]methyl]-4-methoxybenzamide (PubChem CID 42862547) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is N-cyclopentyl-N-[[4-(furan-2-ylmethyl)morpholin-2-yl]methyl]-4-methoxybenzamide.
| Compound Name | N-cyclopentyl-N-[[4-(furan-2-ylmethyl)morpholin-2-yl]methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 42862547 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | N-cyclopentyl-N-[[4-(furan-2-ylmethyl)morpholin-2-yl]methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)N(CC2CN(Cc3ccco3)CCO2)C2CCCC2)cc1 |
| InChI | InChI=1S/C23H30N2O4/c1-27-20-10-8-18(9-11-20)23(26)25(19-5-2-3-6-19)17-22-16-24(12-14-29-22)15-21-7-4-13-28-21/h4,7-11,13,19,22H,2-3,5-6,12,14-17H2,1H3 |
| InChIKey | PEJHNDDZMDXVNX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |