C24H29FN2O3 — CID 92989874
N-cyclopentyl-4-fluoro-N-[[(2S)-4-[(2-hydroxyphenyl)methyl]morpholin-2-yl]methyl]benzamide (PubChem CID 92989874) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is N-cyclopentyl-4-fluoro-N-[[(2S)-4-[(2-hydroxyphenyl)methyl]morpholin-2-yl]methyl]benzamide.
| Compound Name | N-cyclopentyl-4-fluoro-N-[[(2S)-4-[(2-hydroxyphenyl)methyl]morpholin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 92989874 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-cyclopentyl-4-fluoro-N-[[(2S)-4-[(2-hydroxyphenyl)methyl]morpholin-2-yl]methyl]benzamide |
| SMILES | O=C(c1ccc(F)cc1)N(C[C@@H]1CN(Cc2ccccc2O)CCO1)C1CCCC1 |
| InChI | InChI=1S/C24H29FN2O3/c25-20-11-9-18(10-12-20)24(29)27(21-6-2-3-7-21)17-22-16-26(13-14-30-22)15-19-5-1-4-8-23(19)28/h1,4-5,8-12,21-22,28H,2-3,6-7,13-17H2/t22-/m0/s1 |
| InChIKey | FQDWKKQQEXRTHP-QFIPXVFZSA-N |
| XLogP | 3.82 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|