C25H29FN2O3 — CID 42861743
N-cyclopentyl-4-fluoro-N-[[4-(2-methylbenzoyl)morpholin-2-yl]methyl]benzamide (PubChem CID 42861743) has the molecular formula C25H29FN2O3 and a molecular weight of 424.52 g/mol. Its IUPAC name is N-cyclopentyl-4-fluoro-N-[[4-(2-methylbenzoyl)morpholin-2-yl]methyl]benzamide.
| Compound Name | N-cyclopentyl-4-fluoro-N-[[4-(2-methylbenzoyl)morpholin-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 42861743 |
| Molecular Formula | C25H29FN2O3 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | N-cyclopentyl-4-fluoro-N-[[4-(2-methylbenzoyl)morpholin-2-yl]methyl]benzamide |
| SMILES | Cc1ccccc1C(=O)N1CCOC(CN(C(=O)c2ccc(F)cc2)C2CCCC2)C1 |
| InChI | InChI=1S/C25H29FN2O3/c1-18-6-2-5-9-23(18)25(30)27-14-15-31-22(16-27)17-28(21-7-3-4-8-21)24(29)19-10-12-20(26)13-11-19/h2,5-6,9-13,21-22H,3-4,7-8,14-17H2,1H3 |
| InChIKey | JVKHKAUUESPSGJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |