C21H28N2O4 — CID 42849325
N-[[4-(furan-2-ylmethyl)morpholin-2-yl]methyl]-N-(2-methoxyethyl)-2-phenylacetamide (PubChem CID 42849325) has the molecular formula C21H28N2O4 and a molecular weight of 372.46 g/mol. Its IUPAC name is N-[[4-(furan-2-ylmethyl)morpholin-2-yl]methyl]-N-(2-methoxyethyl)-2-phenylacetamide.
| Compound Name | N-[[4-(furan-2-ylmethyl)morpholin-2-yl]methyl]-N-(2-methoxyethyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 42849325 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-[[4-(furan-2-ylmethyl)morpholin-2-yl]methyl]-N-(2-methoxyethyl)-2-phenylacetamide |
| SMILES | COCCN(CC1CN(Cc2ccco2)CCO1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C21H28N2O4/c1-25-12-10-23(21(24)14-18-6-3-2-4-7-18)17-20-16-22(9-13-27-20)15-19-8-5-11-26-19/h2-8,11,20H,9-10,12-17H2,1H3 |
| InChIKey | IHEPAQBEMQZHND-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |