C26H33FN4O4S — CID 46060405
N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-3-methoxy-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 46060405) has the molecular formula C26H33FN4O4S and a molecular weight of 516.64 g/mol. Its IUPAC name is N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-3-methoxy-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-3-methoxy-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 46060405 |
| Molecular Formula | C26H33FN4O4S |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-3-methoxy-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | COc1cccc(C(=O)N(CCN2CCOCC2)CC2CN(C(=S)Nc3ccc(F)cc3)CCO2)c1 |
| InChI | InChI=1S/C26H33FN4O4S/c1-33-23-4-2-3-20(17-23)25(32)30(10-9-29-11-14-34-15-12-29)18-24-19-31(13-16-35-24)26(36)28-22-7-5-21(27)6-8-22/h2-8,17,24H,9-16,18-19H2,1H3,(H,28,36) |
| InChIKey | LPSYNWIEBWOUBT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|