C24H28FN3O3S — CID 46060412
N-(cyclopropylmethyl)-N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-2-methoxybenzamide (PubChem CID 46060412) has the molecular formula C24H28FN3O3S and a molecular weight of 457.57 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-2-methoxybenzamide.
| Compound Name | N-(cyclopropylmethyl)-N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 46060412 |
| Molecular Formula | C24H28FN3O3S |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[[4-[(4-fluorophenyl)carbamothioyl]morpholin-2-yl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)N(CC1CC1)CC1CN(C(=S)Nc2ccc(F)cc2)CCO1 |
| InChI | InChI=1S/C24H28FN3O3S/c1-30-22-5-3-2-4-21(22)23(29)28(14-17-6-7-17)16-20-15-27(12-13-31-20)24(32)26-19-10-8-18(25)9-11-19/h2-5,8-11,17,20H,6-7,12-16H2,1H3,(H,26,32) |
| InChIKey | WXLMJYSQDOCNBB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|