C21H29N3O4 — CID 46060541
2-[[cyclopropylmethyl-(2-methoxybenzoyl)amino]methyl]-N-prop-2-enylmorpholine-4-carboxamide (PubChem CID 46060541) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-[[cyclopropylmethyl-(2-methoxybenzoyl)amino]methyl]-N-prop-2-enylmorpholine-4-carboxamide.
| Compound Name | 2-[[cyclopropylmethyl-(2-methoxybenzoyl)amino]methyl]-N-prop-2-enylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 46060541 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 2-[[cyclopropylmethyl-(2-methoxybenzoyl)amino]methyl]-N-prop-2-enylmorpholine-4-carboxamide |
| SMILES | C=CCNC(=O)N1CCOC(CN(CC2CC2)C(=O)c2ccccc2OC)C1 |
| InChI | InChI=1S/C21H29N3O4/c1-3-10-22-21(26)23-11-12-28-17(14-23)15-24(13-16-8-9-16)20(25)18-6-4-5-7-19(18)27-2/h3-7,16-17H,1,8-15H2,2H3,(H,22,26) |
| InChIKey | NEUNABJRWSOJGE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|