C20H28N4O3 — CID 42862667
2-[[cyclopentyl(pyridine-3-carbonyl)amino]methyl]-N-prop-2-enylmorpholine-4-carboxamide (PubChem CID 42862667) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is 2-[[cyclopentyl(pyridine-3-carbonyl)amino]methyl]-N-prop-2-enylmorpholine-4-carboxamide.
| Compound Name | 2-[[cyclopentyl(pyridine-3-carbonyl)amino]methyl]-N-prop-2-enylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 42862667 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 2-[[cyclopentyl(pyridine-3-carbonyl)amino]methyl]-N-prop-2-enylmorpholine-4-carboxamide |
| SMILES | C=CCNC(=O)N1CCOC(CN(C(=O)c2cccnc2)C2CCCC2)C1 |
| InChI | InChI=1S/C20H28N4O3/c1-2-9-22-20(26)23-11-12-27-18(14-23)15-24(17-7-3-4-8-17)19(25)16-6-5-10-21-13-16/h2,5-6,10,13,17-18H,1,3-4,7-9,11-12,14-15H2,(H,22,26) |
| InChIKey | MZLIDXWAUMUKOK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|