C19H26FN3O3 — CID 92990154
(2R)-2-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]-N-ethylmorpholine-4-carboxamide (PubChem CID 92990154) has the molecular formula C19H26FN3O3 and a molecular weight of 363.43 g/mol. Its IUPAC name is (2R)-2-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]-N-ethylmorpholine-4-carboxamide.
| Compound Name | (2R)-2-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]-N-ethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 92990154 |
| Molecular Formula | C19H26FN3O3 |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (2R)-2-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]-N-ethylmorpholine-4-carboxamide |
| SMILES | CCNC(=O)N1CCO[C@H](CN(CC2CC2)C(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H26FN3O3/c1-2-21-19(25)22-8-9-26-17(12-22)13-23(11-14-6-7-14)18(24)15-4-3-5-16(20)10-15/h3-5,10,14,17H,2,6-9,11-13H2,1H3,(H,21,25)/t17-/m0/s1 |
| InChIKey | JNGOAOBSNIKFDF-KRWDZBQOSA-N |
| XLogP | 2.11 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |