C24H28FN3O3 — CID 46060532
N-benzyl-2-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]morpholine-4-carboxamide (PubChem CID 46060532) has the molecular formula C24H28FN3O3 and a molecular weight of 425.50 g/mol. Its IUPAC name is N-benzyl-2-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]morpholine-4-carboxamide.
| Compound Name | N-benzyl-2-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]morpholine-4-carboxamide |
|---|---|
| PubChem CID | 46060532 |
| Molecular Formula | C24H28FN3O3 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | N-benzyl-2-[[cyclopropylmethyl-(3-fluorobenzoyl)amino]methyl]morpholine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCOC(CN(CC2CC2)C(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C24H28FN3O3/c25-21-8-4-7-20(13-21)23(29)28(15-19-9-10-19)17-22-16-27(11-12-31-22)24(30)26-14-18-5-2-1-3-6-18/h1-8,13,19,22H,9-12,14-17H2,(H,26,30) |
| InChIKey | SLNYUQYJIPXZGO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |