C26H33N3O5S — CID 3866913
N-[2-(2,5-dimethoxyphenyl)ethyl]-4-[2-oxo-5-(phenoxymethyl)-1,3-oxazolidin-3-yl]piperidine-1-carbothioamide (PubChem CID 3866913) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxyphenyl)ethyl]-4-[2-oxo-5-(phenoxymethyl)-1,3-oxazolidin-3-yl]piperidine-1-carbothioamide.
| Compound Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-4-[2-oxo-5-(phenoxymethyl)-1,3-oxazolidin-3-yl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3866913 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-4-[2-oxo-5-(phenoxymethyl)-1,3-oxazolidin-3-yl]piperidine-1-carbothioamide |
| SMILES | COc1ccc(OC)c(CCNC(=S)N2CCC(N3CC(COc4ccccc4)OC3=O)CC2)c1 |
| InChI | InChI=1S/C26H33N3O5S/c1-31-22-8-9-24(32-2)19(16-22)10-13-27-25(35)28-14-11-20(12-15-28)29-17-23(34-26(29)30)18-33-21-6-4-3-5-7-21/h3-9,16,20,23H,10-15,17-18H2,1-2H3,(H,27,35) |
| InChIKey | FODXSKOMZPXPRR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|