C20H29N3O4S — CID 3708597
N-[2-(2,5-dimethoxyphenyl)ethyl]-4-(5-methyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide (PubChem CID 3708597) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxyphenyl)ethyl]-4-(5-methyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide.
| Compound Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-4-(5-methyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 3708597 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[2-(2,5-dimethoxyphenyl)ethyl]-4-(5-methyl-2-oxo-1,3-oxazolidin-3-yl)piperidine-1-carbothioamide |
| SMILES | COc1ccc(OC)c(CCNC(=S)N2CCC(N3CC(C)OC3=O)CC2)c1 |
| InChI | InChI=1S/C20H29N3O4S/c1-14-13-23(20(24)27-14)16-7-10-22(11-8-16)19(28)21-9-6-15-12-17(25-2)4-5-18(15)26-3/h4-5,12,14,16H,6-11,13H2,1-3H3,(H,21,28) |
| InChIKey | FYQUFAXIRDYCKL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|