C22H23N5O5S — CID 4679305
1,3-benzothiazol-6-yl-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]methanone (PubChem CID 4679305) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is 1,3-benzothiazol-6-yl-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]methanone.
| Compound Name | 1,3-benzothiazol-6-yl-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 4679305 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 1,3-benzothiazol-6-yl-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]methanone |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(C(=O)c3ccc4ncsc4c3)CCO2)n1 |
| InChI | InChI=1S/C22H23N5O5S/c1-3-8-30-20-24-21(31-9-4-2)26-22(25-20)32-13-16-12-27(7-10-29-16)19(28)15-5-6-17-18(11-15)33-14-23-17/h3-6,11,14,16H,1-2,7-10,12-13H2 |
| InChIKey | QRTIKODZALEUIC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 108.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|