C14H14N2O3S — CID 81118458
(3R)-1-(1,3-benzothiazole-6-carbonyl)piperidine-3-carboxylic acid (PubChem CID 81118458) has the molecular formula C14H14N2O3S and a molecular weight of 290.34 g/mol. Its IUPAC name is (3R)-1-(1,3-benzothiazole-6-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(1,3-benzothiazole-6-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 81118458 |
| Molecular Formula | C14H14N2O3S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (3R)-1-(1,3-benzothiazole-6-carbonyl)piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CCCN(C(=O)c2ccc3ncsc3c2)C1 |
| InChI | InChI=1S/C14H14N2O3S/c17-13(16-5-1-2-10(7-16)14(18)19)9-3-4-11-12(6-9)20-8-15-11/h3-4,6,8,10H,1-2,5,7H2,(H,18,19)/t10-/m1/s1 |
| InChIKey | YCJMEUAZFUNHRK-SNVBAGLBSA-N |
| XLogP | 2.23 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |