C18H17N3OS — CID 2496275
1,3-benzothiazol-6-yl-(4-phenylpiperazin-1-yl)methanone (PubChem CID 2496275) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 1,3-benzothiazol-6-yl-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | 1,3-benzothiazol-6-yl-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 2496275 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1,3-benzothiazol-6-yl-(4-phenylpiperazin-1-yl)methanone |
| SMILES | O=C(c1ccc2ncsc2c1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C18H17N3OS/c22-18(14-6-7-16-17(12-14)23-13-19-16)21-10-8-20(9-11-21)15-4-2-1-3-5-15/h1-7,12-13H,8-11H2 |
| InChIKey | SRNHDWFIUJYEDI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |