C25H23N3OS — CID 9337184
(4-benzhydrylpiperazin-1-yl)-(1,3-benzothiazol-6-yl)methanone (PubChem CID 9337184) has the molecular formula C25H23N3OS and a molecular weight of 413.55 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-(1,3-benzothiazol-6-yl)methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-(1,3-benzothiazol-6-yl)methanone |
|---|---|
| PubChem CID | 9337184 |
| Molecular Formula | C25H23N3OS |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-(1,3-benzothiazol-6-yl)methanone |
| SMILES | O=C(c1ccc2ncsc2c1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H23N3OS/c29-25(21-11-12-22-23(17-21)30-18-26-22)28-15-13-27(14-16-28)24(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,17-18,24H,13-16H2 |
| InChIKey | MEKPHJIUBOPEED-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |