C20H19ClN2OS — CID 121146423
1,3-benzothiazol-6-yl-[3-(4-chlorophenyl)azepan-1-yl]methanone (PubChem CID 121146423) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is 1,3-benzothiazol-6-yl-[3-(4-chlorophenyl)azepan-1-yl]methanone.
| Compound Name | 1,3-benzothiazol-6-yl-[3-(4-chlorophenyl)azepan-1-yl]methanone |
|---|---|
| PubChem CID | 121146423 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1,3-benzothiazol-6-yl-[3-(4-chlorophenyl)azepan-1-yl]methanone |
| SMILES | O=C(c1ccc2ncsc2c1)N1CCCCC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H19ClN2OS/c21-17-7-4-14(5-8-17)16-3-1-2-10-23(12-16)20(24)15-6-9-18-19(11-15)25-13-22-18/h4-9,11,13,16H,1-3,10,12H2 |
| InChIKey | OALFNDJOPNXDQE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |