C20H31N4O8P — CID 3762778
1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-2-diethoxyphosphorylethanone (PubChem CID 3762778) has the molecular formula C20H31N4O8P and a molecular weight of 486.46 g/mol. Its IUPAC name is 1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-2-diethoxyphosphorylethanone.
| Compound Name | 1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-2-diethoxyphosphorylethanone |
|---|---|
| PubChem CID | 3762778 |
| Molecular Formula | C20H31N4O8P |
| Molecular Weight | 486.46 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 1-[2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]morpholin-4-yl]-2-diethoxyphosphorylethanone |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(C(=O)CP(=O)(OCC)OCC)CCO2)n1 |
| InChI | InChI=1S/C20H31N4O8P/c1-5-10-28-18-21-19(29-11-6-2)23-20(22-18)30-14-16-13-24(9-12-27-16)17(25)15-33(26,31-7-3)32-8-4/h5-6,16H,1-2,7-15H2,3-4H3 |
| InChIKey | HEXCYMMLTKHQHM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 131.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|