C21H23F3N4O6S — CID 3804573
2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[4-(trifluoromethyl)phenyl]sulfonylmorpholine (PubChem CID 3804573) has the molecular formula C21H23F3N4O6S and a molecular weight of 516.50 g/mol. Its IUPAC name is 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[4-(trifluoromethyl)phenyl]sulfonylmorpholine.
| Compound Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[4-(trifluoromethyl)phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 3804573 |
| Molecular Formula | C21H23F3N4O6S |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2-[[4,6-bis(prop-2-enoxy)-1,3,5-triazin-2-yl]oxymethyl]-4-[4-(trifluoromethyl)phenyl]sulfonylmorpholine |
| SMILES | C=CCOc1nc(OCC=C)nc(OCC2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)CCO2)n1 |
| InChI | InChI=1S/C21H23F3N4O6S/c1-3-10-32-18-25-19(33-11-4-2)27-20(26-18)34-14-16-13-28(9-12-31-16)35(29,30)17-7-5-15(6-8-17)21(22,23)24/h3-8,16H,1-2,9-14H2 |
| InChIKey | ITMXLUSCSOADPH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 112.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|