C12H13N3O3S2 — CID 124961088
(2R)-2-pyrazin-2-yl-4-thiophen-2-ylsulfonylmorpholine (PubChem CID 124961088) has the molecular formula C12H13N3O3S2 and a molecular weight of 311.39 g/mol. Its IUPAC name is (2R)-2-pyrazin-2-yl-4-thiophen-2-ylsulfonylmorpholine.
| Compound Name | (2R)-2-pyrazin-2-yl-4-thiophen-2-ylsulfonylmorpholine |
|---|---|
| PubChem CID | 124961088 |
| Molecular Formula | C12H13N3O3S2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | (2R)-2-pyrazin-2-yl-4-thiophen-2-ylsulfonylmorpholine |
| SMILES | O=S(=O)(c1cccs1)N1CCO[C@@H](c2cnccn2)C1 |
| InChI | InChI=1S/C12H13N3O3S2/c16-20(17,12-2-1-7-19-12)15-5-6-18-11(9-15)10-8-13-3-4-14-10/h1-4,7-8,11H,5-6,9H2/t11-/m1/s1 |
| InChIKey | GZAMJMZAAQDSQQ-LLVKDONJSA-N |
| XLogP | 1.30 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |