C14H14FN3O3S — CID 124978418
(2R)-4-(3-fluorophenyl)sulfonyl-2-pyrazin-2-ylmorpholine (PubChem CID 124978418) has the molecular formula C14H14FN3O3S and a molecular weight of 323.35 g/mol. Its IUPAC name is (2R)-4-(3-fluorophenyl)sulfonyl-2-pyrazin-2-ylmorpholine.
| Compound Name | (2R)-4-(3-fluorophenyl)sulfonyl-2-pyrazin-2-ylmorpholine |
|---|---|
| PubChem CID | 124978418 |
| Molecular Formula | C14H14FN3O3S |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | (2R)-4-(3-fluorophenyl)sulfonyl-2-pyrazin-2-ylmorpholine |
| SMILES | O=S(=O)(c1cccc(F)c1)N1CCO[C@@H](c2cnccn2)C1 |
| InChI | InChI=1S/C14H14FN3O3S/c15-11-2-1-3-12(8-11)22(19,20)18-6-7-21-14(10-18)13-9-16-4-5-17-13/h1-5,8-9,14H,6-7,10H2/t14-/m1/s1 |
| InChIKey | LTSZNZSXSUBBCF-CQSZACIVSA-N |
| XLogP | 1.38 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |