C13H15N3O4S2 — CID 137140127
4-methyl-2-[(2R)-4-thiophen-2-ylsulfonylmorpholin-2-yl]-1H-pyrimidin-6-one (PubChem CID 137140127) has the molecular formula C13H15N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-methyl-2-[(2R)-4-thiophen-2-ylsulfonylmorpholin-2-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-2-[(2R)-4-thiophen-2-ylsulfonylmorpholin-2-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137140127 |
| Molecular Formula | C13H15N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-methyl-2-[(2R)-4-thiophen-2-ylsulfonylmorpholin-2-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c([C@H]2CN(S(=O)(=O)c3cccs3)CCO2)n1 |
| InChI | InChI=1S/C13H15N3O4S2/c1-9-7-11(17)15-13(14-9)10-8-16(4-5-20-10)22(18,19)12-3-2-6-21-12/h2-3,6-7,10H,4-5,8H2,1H3,(H,14,15,17)/t10-/m1/s1 |
| InChIKey | QBQBDNLJSIBMPI-SNVBAGLBSA-N |
| XLogP | 0.90 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |