C15H23N3O4S — CID 137052887
2-[(2S)-4-cyclohexylsulfonylmorpholin-2-yl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 137052887) has the molecular formula C15H23N3O4S and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[(2S)-4-cyclohexylsulfonylmorpholin-2-yl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(2S)-4-cyclohexylsulfonylmorpholin-2-yl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137052887 |
| Molecular Formula | C15H23N3O4S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[(2S)-4-cyclohexylsulfonylmorpholin-2-yl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c([C@@H]2CN(S(=O)(=O)C3CCCCC3)CCO2)n1 |
| InChI | InChI=1S/C15H23N3O4S/c1-11-9-14(19)17-15(16-11)13-10-18(7-8-22-13)23(20,21)12-5-3-2-4-6-12/h9,12-13H,2-8,10H2,1H3,(H,16,17,19)/t13-/m0/s1 |
| InChIKey | NFKYKXLSSVERBT-ZDUSSCGKSA-N |
| XLogP | 1.11 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |