C16H25N3O3S — CID 124978136
2-[(2R)-4-cyclopentylsulfonylmorpholin-2-yl]-N,6-dimethylpyridin-4-amine (PubChem CID 124978136) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-[(2R)-4-cyclopentylsulfonylmorpholin-2-yl]-N,6-dimethylpyridin-4-amine.
| Compound Name | 2-[(2R)-4-cyclopentylsulfonylmorpholin-2-yl]-N,6-dimethylpyridin-4-amine |
|---|---|
| PubChem CID | 124978136 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 2-[(2R)-4-cyclopentylsulfonylmorpholin-2-yl]-N,6-dimethylpyridin-4-amine |
| SMILES | CNc1cc(C)nc([C@H]2CN(S(=O)(=O)C3CCCC3)CCO2)c1 |
| InChI | InChI=1S/C16H25N3O3S/c1-12-9-13(17-2)10-15(18-12)16-11-19(7-8-22-16)23(20,21)14-5-3-4-6-14/h9-10,14,16H,3-8,11H2,1-2H3,(H,17,18)/t16-/m1/s1 |
| InChIKey | LRPLUXCLCSHBMS-MRXNPFEDSA-N |
| XLogP | 2.08 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |