C12H20Cl2N2 — CID 172850229
2-cyclopentyl-N,6-dimethylpyridin-4-amine;dihydrochloride (PubChem CID 172850229) has the molecular formula C12H20Cl2N2 and a molecular weight of 263.21 g/mol. Its IUPAC name is 2-cyclopentyl-N,6-dimethylpyridin-4-amine;dihydrochloride.
| Compound Name | 2-cyclopentyl-N,6-dimethylpyridin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 172850229 |
| Molecular Formula | C12H20Cl2N2 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-cyclopentyl-N,6-dimethylpyridin-4-amine;dihydrochloride |
| SMILES | CNc1cc(C)nc(C2CCCC2)c1.Cl.Cl |
| InChI | InChI=1S/C12H18N2.2ClH/c1-9-7-11(13-2)8-12(14-9)10-5-3-4-6-10;;/h7-8,10H,3-6H2,1-2H3,(H,13,14);2*1H |
| InChIKey | XYTGXOAJCWPTOU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |