C17H24N4O4 — CID 136793093
1-[2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)morpholin-4-yl]-2-oxoethyl]azepan-2-one (PubChem CID 136793093) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1-[2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)morpholin-4-yl]-2-oxoethyl]azepan-2-one.
| Compound Name | 1-[2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)morpholin-4-yl]-2-oxoethyl]azepan-2-one |
|---|---|
| PubChem CID | 136793093 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 1-[2-[2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)morpholin-4-yl]-2-oxoethyl]azepan-2-one |
| SMILES | Cc1cc(=O)[nH]c(C2CN(C(=O)CN3CCCCCC3=O)CCO2)n1 |
| InChI | InChI=1S/C17H24N4O4/c1-12-9-14(22)19-17(18-12)13-10-21(7-8-25-13)16(24)11-20-6-4-2-3-5-15(20)23/h9,13H,2-8,10-11H2,1H3,(H,18,19,22) |
| InChIKey | QDHXXIKNVCZJBE-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |