C14H15N5O3 — CID 137168597
4-methyl-2-[(2S)-4-(pyrimidine-5-carbonyl)morpholin-2-yl]-1H-pyrimidin-6-one (PubChem CID 137168597) has the molecular formula C14H15N5O3 and a molecular weight of 301.31 g/mol. Its IUPAC name is 4-methyl-2-[(2S)-4-(pyrimidine-5-carbonyl)morpholin-2-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-methyl-2-[(2S)-4-(pyrimidine-5-carbonyl)morpholin-2-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137168597 |
| Molecular Formula | C14H15N5O3 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-methyl-2-[(2S)-4-(pyrimidine-5-carbonyl)morpholin-2-yl]-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c([C@@H]2CN(C(=O)c3cncnc3)CCO2)n1 |
| InChI | InChI=1S/C14H15N5O3/c1-9-4-12(20)18-13(17-9)11-7-19(2-3-22-11)14(21)10-5-15-8-16-6-10/h4-6,8,11H,2-3,7H2,1H3,(H,17,18,20)/t11-/m0/s1 |
| InChIKey | JFGYFTZDJKTBEG-NSHDSACASA-N |
| XLogP | 0.08 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |