C23H24N2O3 — CID 15662364
2-[4-(8-hydroxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]isoindole-1,3-dione (PubChem CID 15662364) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 2-[4-(8-hydroxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(8-hydroxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 15662364 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 2-[4-(8-hydroxy-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-2-yl)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCCN1CC2Cc3cccc(O)c3C2C1 |
| InChI | InChI=1S/C23H24N2O3/c26-20-9-5-6-15-12-16-13-24(14-19(16)21(15)20)10-3-4-11-25-22(27)17-7-1-2-8-18(17)23(25)28/h1-2,5-9,16,19,26H,3-4,10-14H2 |
| InChIKey | MAPHFIVXCZRENI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|