C26H37ClN2O3 — CID 18646950
8-[4-[(3aS,9bR)-9-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride (PubChem CID 18646950) has the molecular formula C26H37ClN2O3 and a molecular weight of 461.05 g/mol. Its IUPAC name is 8-[4-[(3aS,9bR)-9-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride.
| Compound Name | 8-[4-[(3aS,9bR)-9-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride |
|---|---|
| PubChem CID | 18646950 |
| Molecular Formula | C26H37ClN2O3 |
| Molecular Weight | 461.05 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 8-[4-[(3aS,9bR)-9-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione;hydrochloride |
| SMILES | COc1cccc2c1[C@@H]1CN(CCCCN3C(=O)CC4(CCCC4)CC3=O)C[C@H]1CC2.Cl |
| InChI | InChI=1S/C26H36N2O3.ClH/c1-31-22-8-6-7-19-9-10-20-17-27(18-21(20)25(19)22)13-4-5-14-28-23(29)15-26(16-24(28)30)11-2-3-12-26;/h6-8,20-21H,2-5,9-18H2,1H3;1H/t20-,21-;/m1./s1 |
| InChIKey | HYHFUALRDKOIND-MUCZFFFMSA-N |
| XLogP | 4.57 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.05 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|