C24H35ClN2O3 — CID 19021507
1-[4-(6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl)butyl]-4,4-dimethylpiperidine-2,6-dione;hydrochloride (PubChem CID 19021507) has the molecular formula C24H35ClN2O3 and a molecular weight of 435.01 g/mol. Its IUPAC name is 1-[4-(6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl)butyl]-4,4-dimethylpiperidine-2,6-dione;hydrochloride.
| Compound Name | 1-[4-(6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl)butyl]-4,4-dimethylpiperidine-2,6-dione;hydrochloride |
|---|---|
| PubChem CID | 19021507 |
| Molecular Formula | C24H35ClN2O3 |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1-[4-(6-methoxy-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl)butyl]-4,4-dimethylpiperidine-2,6-dione;hydrochloride |
| SMILES | COc1cccc2c1CCC1C2CCN1CCCCN1C(=O)CC(C)(C)CC1=O.Cl |
| InChI | InChI=1S/C24H34N2O3.ClH/c1-24(2)15-22(27)26(23(28)16-24)13-5-4-12-25-14-11-18-17-7-6-8-21(29-3)19(17)9-10-20(18)25;/h6-8,18,20H,4-5,9-16H2,1-3H3;1H |
| InChIKey | IYIIQZWEKMYBMY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|