C24H37ClN2O2 — CID 19021451
[3-(3-cyclohexylpropyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 19021451) has the molecular formula C24H37ClN2O2 and a molecular weight of 421.03 g/mol. Its IUPAC name is [3-(3-cyclohexylpropyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride.
| Compound Name | [3-(3-cyclohexylpropyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 19021451 |
| Molecular Formula | C24H37ClN2O2 |
| Molecular Weight | 421.03 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [3-(3-cyclohexylpropyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)C(=O)Oc1cccc2c1CCC1C2CCN1CCCC1CCCCC1.Cl |
| InChI | InChI=1S/C24H36N2O2.ClH/c1-25(2)24(27)28-23-12-6-11-19-20-15-17-26(22(20)14-13-21(19)23)16-7-10-18-8-4-3-5-9-18;/h6,11-12,18,20,22H,3-5,7-10,13-17H2,1-2H3;1H |
| InChIKey | XADIUAXDLJPWHD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.03 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |