C22H33N3O2 — CID 19021465
[3-(2-piperidin-1-ylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate (PubChem CID 19021465) has the molecular formula C22H33N3O2 and a molecular weight of 371.53 g/mol. Its IUPAC name is [3-(2-piperidin-1-ylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate.
| Compound Name | [3-(2-piperidin-1-ylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 19021465 |
| Molecular Formula | C22H33N3O2 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.26 |
| IUPAC Name | [3-(2-piperidin-1-ylethyl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cccc2c1CCC1C2CCN1CCN1CCCCC1 |
| InChI | InChI=1S/C22H33N3O2/c1-23(2)22(26)27-21-8-6-7-17-18-11-14-25(20(18)10-9-19(17)21)16-15-24-12-4-3-5-13-24/h6-8,18,20H,3-5,9-16H2,1-2H3 |
| InChIKey | BXGCYCAUIHGOAH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |