C28H40ClN3O4 — CID 67853015
[3-[5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)pentyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 67853015) has the molecular formula C28H40ClN3O4 and a molecular weight of 518.10 g/mol. Its IUPAC name is [3-[5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)pentyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride.
| Compound Name | [3-[5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)pentyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 67853015 |
| Molecular Formula | C28H40ClN3O4 |
| Molecular Weight | 518.10 g/mol |
| Exact Mass | 517.27 |
| IUPAC Name | [3-[5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)pentyl]-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-6-yl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CN(C)C(=O)Oc1cccc2c1CCC1C2CCN1CCCCCN1C(=O)C2CCCCC2C1=O.Cl |
| InChI | InChI=1S/C28H39N3O4.ClH/c1-29(2)28(34)35-25-12-8-11-19-20-15-18-30(24(20)14-13-21(19)25)16-6-3-7-17-31-26(32)22-9-4-5-10-23(22)27(31)33;/h8,11-12,20,22-24H,3-7,9-10,13-18H2,1-2H3;1H |
| InChIKey | YYMMMTMNWCZADH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.10 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|