C18H27ClN2O2 — CID 24836199
[(3aR,9bS)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-9-yl] N,N-dimethylcarbamate;hydrochloride (PubChem CID 24836199) has the molecular formula C18H27ClN2O2 and a molecular weight of 338.88 g/mol. Its IUPAC name is [(3aR,9bS)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-9-yl] N,N-dimethylcarbamate;hydrochloride.
| Compound Name | [(3aR,9bS)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-9-yl] N,N-dimethylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 24836199 |
| Molecular Formula | C18H27ClN2O2 |
| Molecular Weight | 338.88 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | [(3aR,9bS)-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-9-yl] N,N-dimethylcarbamate;hydrochloride |
| SMILES | CCCN1CC[C@H]2c3c(cccc3OC(=O)N(C)C)CC[C@H]21.Cl |
| InChI | InChI=1S/C18H26N2O2.ClH/c1-4-11-20-12-10-14-15(20)9-8-13-6-5-7-16(17(13)14)22-18(21)19(2)3;/h5-7,14-15H,4,8-12H2,1-3H3;1H/t14-,15-;/m1./s1 |
| InChIKey | XMNDONOKEZKWBG-CTHHTMFSSA-N |
| XLogP | 3.68 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.88 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |