C23H34N2O2 — CID 19021529
[1-(3-cyclopentylpropyl)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indol-6-yl] N,N-dimethylcarbamate (PubChem CID 19021529) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is [1-(3-cyclopentylpropyl)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indol-6-yl] N,N-dimethylcarbamate.
| Compound Name | [1-(3-cyclopentylpropyl)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indol-6-yl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 19021529 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | [1-(3-cyclopentylpropyl)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]indol-6-yl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)Oc1cccc2c1CCC1NCC(CCCC3CCCC3)C21 |
| InChI | InChI=1S/C23H34N2O2/c1-25(2)23(26)27-21-12-6-11-19-18(21)13-14-20-22(19)17(15-24-20)10-5-9-16-7-3-4-8-16/h6,11-12,16-17,20,22,24H,3-5,7-10,13-15H2,1-2H3 |
| InChIKey | SOIFCKKJJHJLBQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |