C16H21NO2 — CID 10730003
(3aS,9bS)-6-methoxy-1,1,3-trimethyl-3a,4,5,9b-tetrahydrobenzo[e]indol-2-one (PubChem CID 10730003) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (3aS,9bS)-6-methoxy-1,1,3-trimethyl-3a,4,5,9b-tetrahydrobenzo[e]indol-2-one.
| Compound Name | (3aS,9bS)-6-methoxy-1,1,3-trimethyl-3a,4,5,9b-tetrahydrobenzo[e]indol-2-one |
|---|---|
| PubChem CID | 10730003 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (3aS,9bS)-6-methoxy-1,1,3-trimethyl-3a,4,5,9b-tetrahydrobenzo[e]indol-2-one |
| SMILES | COc1cccc2c1CC[C@H]1[C@@H]2C(C)(C)C(=O)N1C |
| InChI | InChI=1S/C16H21NO2/c1-16(2)14-11-6-5-7-13(19-4)10(11)8-9-12(14)17(3)15(16)18/h5-7,12,14H,8-9H2,1-4H3/t12-,14+/m0/s1 |
| InChIKey | ZFIZTJNOLOVNJH-GXTWGEPZSA-N |
| XLogP | 2.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |