C16H23NO2 — CID 13432829
7-methoxy-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine (PubChem CID 13432829) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 7-methoxy-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine.
| Compound Name | 7-methoxy-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine |
|---|---|
| PubChem CID | 13432829 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 7-methoxy-4-propyl-2,3,4a,5,6,10b-hexahydrobenzo[h][1,4]benzoxazine |
| SMILES | CCCN1CCOC2c3cccc(OC)c3CCC21 |
| InChI | InChI=1S/C16H23NO2/c1-3-9-17-10-11-19-16-13-5-4-6-15(18-2)12(13)7-8-14(16)17/h4-6,14,16H,3,7-11H2,1-2H3 |
| InChIKey | NVNQGYXAHVDXID-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |