C26H36N2O4 — CID 10765574
8-[4-[(3R)-5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-1'-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 10765574) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is 8-[4-[(3R)-5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-1'-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[4-[(3R)-5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-1'-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 10765574 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 8-[4-[(3R)-5-methoxyspiro[2,4-dihydrochromene-3,2'-pyrrolidine]-1'-yl]butyl]-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | COc1cccc2c1C[C@]1(CCCN1CCCCN1C(=O)CC3(CCCC3)CC1=O)CO2 |
| InChI | InChI=1S/C26H36N2O4/c1-31-21-8-6-9-22-20(21)16-26(19-32-22)12-7-14-27(26)13-4-5-15-28-23(29)17-25(18-24(28)30)10-2-3-11-25/h6,8-9H,2-5,7,10-19H2,1H3/t26-/m1/s1 |
| InChIKey | XVCOCVUIJOUBOY-AREMUKBSSA-N |
| XLogP | 3.95 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|