C18H28N2O2 — CID 10542565
4-(5-methoxyspiro[2,4-dihydrochromene-3,2'-piperidine]-1'-yl)butan-1-amine (PubChem CID 10542565) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 4-(5-methoxyspiro[2,4-dihydrochromene-3,2'-piperidine]-1'-yl)butan-1-amine.
| Compound Name | 4-(5-methoxyspiro[2,4-dihydrochromene-3,2'-piperidine]-1'-yl)butan-1-amine |
|---|---|
| PubChem CID | 10542565 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 4-(5-methoxyspiro[2,4-dihydrochromene-3,2'-piperidine]-1'-yl)butan-1-amine |
| SMILES | COc1cccc2c1CC1(CCCCN1CCCCN)CO2 |
| InChI | InChI=1S/C18H28N2O2/c1-21-16-7-6-8-17-15(16)13-18(14-22-17)9-2-4-11-20(18)12-5-3-10-19/h6-8H,2-5,9-14,19H2,1H3 |
| InChIKey | TXCIYSXYJGGUBU-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|