C21H26N2O5 — CID 145256308
8-hydroxy-3,4-dihydro-1H-quinolin-2-one;methane;8-(methoxymethoxy)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 145256308) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is 8-hydroxy-3,4-dihydro-1H-quinolin-2-one;methane;8-(methoxymethoxy)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 8-hydroxy-3,4-dihydro-1H-quinolin-2-one;methane;8-(methoxymethoxy)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 145256308 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 8-hydroxy-3,4-dihydro-1H-quinolin-2-one;methane;8-(methoxymethoxy)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | C.COCOc1cccc2c1NC(=O)CC2.O=C1CCc2cccc(O)c2N1 |
| InChI | InChI=1S/C11H13NO3.C9H9NO2.CH4/c1-14-7-15-9-4-2-3-8-5-6-10(13)12-11(8)9;11-7-3-1-2-6-4-5-8(12)10-9(6)7;/h2-4H,5-7H2,1H3,(H,12,13);1-3,11H,4-5H2,(H,10,12);1H4 |
| InChIKey | IBPSLHQTAZTQDK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|