C9H12INO2 — CID 62706856
3-iodo-4-(methoxymethoxy)-2,6-dimethylpyridine (PubChem CID 62706856) has the molecular formula C9H12INO2 and a molecular weight of 293.10 g/mol. Its IUPAC name is 3-iodo-4-(methoxymethoxy)-2,6-dimethylpyridine.
| Compound Name | 3-iodo-4-(methoxymethoxy)-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 62706856 |
| Molecular Formula | C9H12INO2 |
| Molecular Weight | 293.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | 3-iodo-4-(methoxymethoxy)-2,6-dimethylpyridine |
| SMILES | COCOc1cc(C)nc(C)c1I |
| InChI | InChI=1S/C9H12INO2/c1-6-4-8(13-5-12-3)9(10)7(2)11-6/h4H,5H2,1-3H3 |
| InChIKey | LJKPVMYCYGUKFY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.10 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|