C10H7F6IO2 — CID 163198277
2-iodo-1-(methoxymethoxy)-3,5-bis(trifluoromethyl)benzene (PubChem CID 163198277) has the molecular formula C10H7F6IO2 and a molecular weight of 400.06 g/mol. Its IUPAC name is 2-iodo-1-(methoxymethoxy)-3,5-bis(trifluoromethyl)benzene.
| Compound Name | 2-iodo-1-(methoxymethoxy)-3,5-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 163198277 |
| Molecular Formula | C10H7F6IO2 |
| Molecular Weight | 400.06 g/mol |
| Exact Mass | 399.94 |
| IUPAC Name | 2-iodo-1-(methoxymethoxy)-3,5-bis(trifluoromethyl)benzene |
| SMILES | COCOc1cc(C(F)(F)F)cc(C(F)(F)F)c1I |
| InChI | InChI=1S/C10H7F6IO2/c1-18-4-19-7-3-5(9(11,12)13)2-6(8(7)17)10(14,15)16/h2-3H,4H2,1H3 |
| InChIKey | JFTJORVMSXLILF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.06 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|