C15H14F3NO4S — CID 141001992
N-[2-(methoxymethoxy)-4-(trifluoromethyl)phenyl]benzenesulfonamide (PubChem CID 141001992) has the molecular formula C15H14F3NO4S and a molecular weight of 361.34 g/mol. Its IUPAC name is N-[2-(methoxymethoxy)-4-(trifluoromethyl)phenyl]benzenesulfonamide.
| Compound Name | N-[2-(methoxymethoxy)-4-(trifluoromethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 141001992 |
| Molecular Formula | C15H14F3NO4S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | N-[2-(methoxymethoxy)-4-(trifluoromethyl)phenyl]benzenesulfonamide |
| SMILES | COCOc1cc(C(F)(F)F)ccc1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14F3NO4S/c1-22-10-23-14-9-11(15(16,17)18)7-8-13(14)19-24(20,21)12-5-3-2-4-6-12/h2-9,19H,10H2,1H3 |
| InChIKey | CUDQGGCLGHMBTG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|