C16H14F3NO5S — CID 25331588
methyl 3-[[2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]benzoate (PubChem CID 25331588) has the molecular formula C16H14F3NO5S and a molecular weight of 389.35 g/mol. Its IUPAC name is methyl 3-[[2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]benzoate.
| Compound Name | methyl 3-[[2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25331588 |
| Molecular Formula | C16H14F3NO5S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | methyl 3-[[2-(2,2,2-trifluoroethoxy)phenyl]sulfamoyl]benzoate |
| SMILES | COC(=O)c1cccc(S(=O)(=O)Nc2ccccc2OCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H14F3NO5S/c1-24-15(21)11-5-4-6-12(9-11)26(22,23)20-13-7-2-3-8-14(13)25-10-16(17,18)19/h2-9,20H,10H2,1H3 |
| InChIKey | HNWIDZDQCSYETJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |