C22H20N2O6S — CID 43039121
(4-carbamoylphenyl)methyl 3-[(2-methoxyphenyl)sulfamoyl]benzoate (PubChem CID 43039121) has the molecular formula C22H20N2O6S and a molecular weight of 440.48 g/mol. Its IUPAC name is (4-carbamoylphenyl)methyl 3-[(2-methoxyphenyl)sulfamoyl]benzoate.
| Compound Name | (4-carbamoylphenyl)methyl 3-[(2-methoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 43039121 |
| Molecular Formula | C22H20N2O6S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (4-carbamoylphenyl)methyl 3-[(2-methoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccccc1NS(=O)(=O)c1cccc(C(=O)OCc2ccc(C(N)=O)cc2)c1 |
| InChI | InChI=1S/C22H20N2O6S/c1-29-20-8-3-2-7-19(20)24-31(27,28)18-6-4-5-17(13-18)22(26)30-14-15-9-11-16(12-10-15)21(23)25/h2-13,24H,14H2,1H3,(H2,23,25) |
| InChIKey | NSOUHHRQVUPSNV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |