C24H22N2O8S — CID 43012374
[2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 3-[(2-methoxyphenyl)sulfamoyl]benzoate (PubChem CID 43012374) has the molecular formula C24H22N2O8S and a molecular weight of 498.51 g/mol. Its IUPAC name is [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 3-[(2-methoxyphenyl)sulfamoyl]benzoate.
| Compound Name | [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 3-[(2-methoxyphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 43012374 |
| Molecular Formula | C24H22N2O8S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [2-[(4-methoxybenzoyl)amino]-2-oxoethyl] 3-[(2-methoxyphenyl)sulfamoyl]benzoate |
| SMILES | COc1ccc(C(=O)NC(=O)COC(=O)c2cccc(S(=O)(=O)Nc3ccccc3OC)c2)cc1 |
| InChI | InChI=1S/C24H22N2O8S/c1-32-18-12-10-16(11-13-18)23(28)25-22(27)15-34-24(29)17-6-5-7-19(14-17)35(30,31)26-20-8-3-4-9-21(20)33-2/h3-14,26H,15H2,1-2H3,(H,25,27,28) |
| InChIKey | FBTQMCZCHHBZIL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |