C22H22N2O7S2 — CID 3950325
ethyl 4-[[3-[(2-methoxyphenyl)sulfamoyl]phenyl]sulfamoyl]benzoate (PubChem CID 3950325) has the molecular formula C22H22N2O7S2 and a molecular weight of 490.56 g/mol. Its IUPAC name is ethyl 4-[[3-[(2-methoxyphenyl)sulfamoyl]phenyl]sulfamoyl]benzoate.
| Compound Name | ethyl 4-[[3-[(2-methoxyphenyl)sulfamoyl]phenyl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 3950325 |
| Molecular Formula | C22H22N2O7S2 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | ethyl 4-[[3-[(2-methoxyphenyl)sulfamoyl]phenyl]sulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)Nc2cccc(S(=O)(=O)Nc3ccccc3OC)c2)cc1 |
| InChI | InChI=1S/C22H22N2O7S2/c1-3-31-22(25)16-11-13-18(14-12-16)32(26,27)23-17-7-6-8-19(15-17)33(28,29)24-20-9-4-5-10-21(20)30-2/h4-15,23-24H,3H2,1-2H3 |
| InChIKey | NBBFOHAETNFUPV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |